C12H12N2O3 — CID 91607903
6-hydroxy-7-methylspiro[1,2-dihydroindene-3,5'-imidazolidine]-2',4'-dione (PubChem CID 91607903) has the molecular formula C12H12N2O3 and a molecular weight of 232.24 g/mol. Its IUPAC name is 6-hydroxy-7-methylspiro[1,2-dihydroindene-3,5'-imidazolidine]-2',4'-dione.
| Compound Name | 6-hydroxy-7-methylspiro[1,2-dihydroindene-3,5'-imidazolidine]-2',4'-dione |
|---|---|
| PubChem CID | 91607903 |
| Molecular Formula | C12H12N2O3 |
| Molecular Weight | 232.24 g/mol |
| Exact Mass | 232.08 |
| IUPAC Name | 6-hydroxy-7-methylspiro[1,2-dihydroindene-3,5'-imidazolidine]-2',4'-dione |
| SMILES | Cc1c(O)ccc2c1CCC21NC(=O)NC1=O |
| InChI | InChI=1S/C12H12N2O3/c1-6-7-4-5-12(8(7)2-3-9(6)15)10(16)13-11(17)14-12/h2-3,15H,4-5H2,1H3,(H2,13,14,16,17) |
| InChIKey | HJMJVIWNBJHUFT-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.24 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|