C13H13N3O3 — CID 118956972
N-(2',5'-dioxospiro[2,3-dihydroindene-1,4'-imidazolidine]-5-yl)acetamide (PubChem CID 118956972) has the molecular formula C13H13N3O3 and a molecular weight of 259.26 g/mol. Its IUPAC name is N-(2',5'-dioxospiro[2,3-dihydroindene-1,4'-imidazolidine]-5-yl)acetamide.
| Compound Name | N-(2',5'-dioxospiro[2,3-dihydroindene-1,4'-imidazolidine]-5-yl)acetamide |
|---|---|
| PubChem CID | 118956972 |
| Molecular Formula | C13H13N3O3 |
| Molecular Weight | 259.26 g/mol |
| Exact Mass | 259.10 |
| IUPAC Name | N-(2',5'-dioxospiro[2,3-dihydroindene-1,4'-imidazolidine]-5-yl)acetamide |
| SMILES | CC(=O)Nc1ccc2c(c1)CCC21NC(=O)NC1=O |
| InChI | InChI=1S/C13H13N3O3/c1-7(17)14-9-2-3-10-8(6-9)4-5-13(10)11(18)15-12(19)16-13/h2-3,6H,4-5H2,1H3,(H,14,17)(H2,15,16,18,19) |
| InChIKey | GVGIRWGAMDJXBC-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.26 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|