C21H21N3O5 — CID 10386012
N-(2',5'-dioxospiro[7,8-dihydro-5H-naphthalene-6,4'-imidazolidine]-2-yl)-3,5-dimethoxybenzamide (PubChem CID 10386012) has the molecular formula C21H21N3O5 and a molecular weight of 395.42 g/mol. Its IUPAC name is N-(2',5'-dioxospiro[7,8-dihydro-5H-naphthalene-6,4'-imidazolidine]-2-yl)-3,5-dimethoxybenzamide.
| Compound Name | N-(2',5'-dioxospiro[7,8-dihydro-5H-naphthalene-6,4'-imidazolidine]-2-yl)-3,5-dimethoxybenzamide |
|---|---|
| PubChem CID | 10386012 |
| Molecular Formula | C21H21N3O5 |
| Molecular Weight | 395.42 g/mol |
| Exact Mass | 395.15 |
| IUPAC Name | N-(2',5'-dioxospiro[7,8-dihydro-5H-naphthalene-6,4'-imidazolidine]-2-yl)-3,5-dimethoxybenzamide |
| SMILES | COc1cc(OC)cc(C(=O)Nc2ccc3c(c2)CCC2(C3)NC(=O)NC2=O)c1 |
| InChI | InChI=1S/C21H21N3O5/c1-28-16-8-14(9-17(10-16)29-2)18(25)22-15-4-3-13-11-21(6-5-12(13)7-15)19(26)23-20(27)24-21/h3-4,7-10H,5-6,11H2,1-2H3,(H,22,25)(H2,23,24,26,27) |
| InChIKey | CMMZNHRDESPSGZ-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.42 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|