C21H30N4O3 — CID 145475245
N-(2',5'-dioxospiro[1,3-dihydroindene-2,4'-imidazolidine]-5-yl)-2-(octylamino)acetamide (PubChem CID 145475245) has the molecular formula C21H30N4O3 and a molecular weight of 386.50 g/mol. Its IUPAC name is N-(2',5'-dioxospiro[1,3-dihydroindene-2,4'-imidazolidine]-5-yl)-2-(octylamino)acetamide.
| Compound Name | N-(2',5'-dioxospiro[1,3-dihydroindene-2,4'-imidazolidine]-5-yl)-2-(octylamino)acetamide |
|---|---|
| PubChem CID | 145475245 |
| Molecular Formula | C21H30N4O3 |
| Molecular Weight | 386.50 g/mol |
| Exact Mass | 386.23 |
| IUPAC Name | N-(2',5'-dioxospiro[1,3-dihydroindene-2,4'-imidazolidine]-5-yl)-2-(octylamino)acetamide |
| SMILES | CCCCCCCCNCC(=O)Nc1ccc2c(c1)CC1(C2)NC(=O)NC1=O |
| InChI | InChI=1S/C21H30N4O3/c1-2-3-4-5-6-7-10-22-14-18(26)23-17-9-8-15-12-21(13-16(15)11-17)19(27)24-20(28)25-21/h8-9,11,22H,2-7,10,12-14H2,1H3,(H,23,26)(H2,24,25,27,28) |
| InChIKey | HOOKLHHTGXQBNW-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 99.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.50 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|