C20H19N3O5 — CID 10407462
N-(2',5'-dioxospiro[1,3-dihydroindene-2,4'-imidazolidine]-5-yl)-3,5-dimethoxybenzamide (PubChem CID 10407462) has the molecular formula C20H19N3O5 and a molecular weight of 381.39 g/mol. Its IUPAC name is N-(2',5'-dioxospiro[1,3-dihydroindene-2,4'-imidazolidine]-5-yl)-3,5-dimethoxybenzamide.
| Compound Name | N-(2',5'-dioxospiro[1,3-dihydroindene-2,4'-imidazolidine]-5-yl)-3,5-dimethoxybenzamide |
|---|---|
| PubChem CID | 10407462 |
| Molecular Formula | C20H19N3O5 |
| Molecular Weight | 381.39 g/mol |
| Exact Mass | 381.13 |
| IUPAC Name | N-(2',5'-dioxospiro[1,3-dihydroindene-2,4'-imidazolidine]-5-yl)-3,5-dimethoxybenzamide |
| SMILES | COc1cc(OC)cc(C(=O)Nc2ccc3c(c2)CC2(C3)NC(=O)NC2=O)c1 |
| InChI | InChI=1S/C20H19N3O5/c1-27-15-6-12(7-16(8-15)28-2)17(24)21-14-4-3-11-9-20(10-13(11)5-14)18(25)22-19(26)23-20/h3-8H,9-10H2,1-2H3,(H,21,24)(H2,22,23,25,26) |
| InChIKey | WIQOZVKTAWQQEZ-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.39 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|