C21H18N4O3 — CID 10429483
N-(2',5'-dioxospiro[1,3-dihydroindene-2,4'-imidazolidine]-5-yl)-2-indol-1-ylacetamide (PubChem CID 10429483) has the molecular formula C21H18N4O3 and a molecular weight of 374.40 g/mol. Its IUPAC name is N-(2',5'-dioxospiro[1,3-dihydroindene-2,4'-imidazolidine]-5-yl)-2-indol-1-ylacetamide.
| Compound Name | N-(2',5'-dioxospiro[1,3-dihydroindene-2,4'-imidazolidine]-5-yl)-2-indol-1-ylacetamide |
|---|---|
| PubChem CID | 10429483 |
| Molecular Formula | C21H18N4O3 |
| Molecular Weight | 374.40 g/mol |
| Exact Mass | 374.14 |
| IUPAC Name | N-(2',5'-dioxospiro[1,3-dihydroindene-2,4'-imidazolidine]-5-yl)-2-indol-1-ylacetamide |
| SMILES | O=C(Cn1ccc2ccccc21)Nc1ccc2c(c1)CC1(C2)NC(=O)NC1=O |
| InChI | InChI=1S/C21H18N4O3/c26-18(12-25-8-7-13-3-1-2-4-17(13)25)22-16-6-5-14-10-21(11-15(14)9-16)19(27)23-20(28)24-21/h1-9H,10-12H2,(H,22,26)(H2,23,24,27,28) |
| InChIKey | BHGFTMJBESQPEB-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 92.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.40 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|