C23H26N4O4S — CID 159596995
2-(2,2-dimethyl-3-oxo-1,4-benzothiazin-4-yl)-N-(2',5'-dioxospiro[1,3-dihydroindene-2,4'-imidazolidine]-5-yl)acetamide;molecular hydrogen (PubChem CID 159596995) has the molecular formula C23H26N4O4S and a molecular weight of 454.55 g/mol. Its IUPAC name is 2-(2,2-dimethyl-3-oxo-1,4-benzothiazin-4-yl)-N-(2',5'-dioxospiro[1,3-dihydroindene-2,4'-imidazolidine]-5-yl)acetamide;molecular hydrogen.
| Compound Name | 2-(2,2-dimethyl-3-oxo-1,4-benzothiazin-4-yl)-N-(2',5'-dioxospiro[1,3-dihydroindene-2,4'-imidazolidine]-5-yl)acetamide;molecular hydrogen |
|---|---|
| PubChem CID | 159596995 |
| Molecular Formula | C23H26N4O4S |
| Molecular Weight | 454.55 g/mol |
| Exact Mass | 454.17 |
| IUPAC Name | 2-(2,2-dimethyl-3-oxo-1,4-benzothiazin-4-yl)-N-(2',5'-dioxospiro[1,3-dihydroindene-2,4'-imidazolidine]-5-yl)acetamide;molecular hydrogen |
| SMILES | CC1(C)Sc2ccccc2N(CC(=O)Nc2ccc3c(c2)CC2(C3)NC(=O)NC2=O)C1=O.[H][H].[H][H] |
| InChI | InChI=1S/C23H22N4O4S.2H2/c1-22(2)20(30)27(16-5-3-4-6-17(16)32-22)12-18(28)24-15-8-7-13-10-23(11-14(13)9-15)19(29)25-21(31)26-23;;/h3-9H,10-12H2,1-2H3,(H,24,28)(H2,25,26,29,31);2*1H |
| InChIKey | MKZBUUOMUNFJAL-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.55 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|