C13H14N2O4S — CID 21162204
6,7-dimethyl-1,1-dioxospiro[2,3-dihydrothiochromene-4,5'-imidazolidine]-2',4'-dione (PubChem CID 21162204) has the molecular formula C13H14N2O4S and a molecular weight of 294.33 g/mol. Its IUPAC name is 6,7-dimethyl-1,1-dioxospiro[2,3-dihydrothiochromene-4,5'-imidazolidine]-2',4'-dione.
| Compound Name | 6,7-dimethyl-1,1-dioxospiro[2,3-dihydrothiochromene-4,5'-imidazolidine]-2',4'-dione |
|---|---|
| PubChem CID | 21162204 |
| Molecular Formula | C13H14N2O4S |
| Molecular Weight | 294.33 g/mol |
| Exact Mass | 294.07 |
| IUPAC Name | 6,7-dimethyl-1,1-dioxospiro[2,3-dihydrothiochromene-4,5'-imidazolidine]-2',4'-dione |
| SMILES | Cc1cc2c(cc1C)S(=O)(=O)CCC21NC(=O)NC1=O |
| InChI | InChI=1S/C13H14N2O4S/c1-7-5-9-10(6-8(7)2)20(18,19)4-3-13(9)11(16)14-12(17)15-13/h5-6H,3-4H2,1-2H3,(H2,14,15,16,17) |
| InChIKey | XFSZVUNSGMQRSC-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.33 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|