C12H13BrO — CID 115010938
7-bromo-1,1-dimethyl-3,4-dihydronaphthalen-2-one (PubChem CID 115010938) has the molecular formula C12H13BrO and a molecular weight of 253.14 g/mol. Its IUPAC name is 7-bromo-1,1-dimethyl-3,4-dihydronaphthalen-2-one.
| Compound Name | 7-bromo-1,1-dimethyl-3,4-dihydronaphthalen-2-one |
|---|---|
| PubChem CID | 115010938 |
| Molecular Formula | C12H13BrO |
| Molecular Weight | 253.14 g/mol |
| Exact Mass | 252.01 |
| IUPAC Name | 7-bromo-1,1-dimethyl-3,4-dihydronaphthalen-2-one |
| SMILES | CC1(C)C(=O)CCc2ccc(Br)cc21 |
| InChI | InChI=1S/C12H13BrO/c1-12(2)10-7-9(13)5-3-8(10)4-6-11(12)14/h3,5,7H,4,6H2,1-2H3 |
| InChIKey | PHZFQPLGQHNZAM-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.14 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |