C23H12Br2O3 — CID 102052848
2',7'-dibromospiro[5,7-dihydrocyclopenta[f][2]benzofuran-6,9'-fluorene]-1,3-dione (PubChem CID 102052848) has the molecular formula C23H12Br2O3 and a molecular weight of 496.15 g/mol. Its IUPAC name is 2',7'-dibromospiro[5,7-dihydrocyclopenta[f][2]benzofuran-6,9'-fluorene]-1,3-dione.
| Compound Name | 2',7'-dibromospiro[5,7-dihydrocyclopenta[f][2]benzofuran-6,9'-fluorene]-1,3-dione |
|---|---|
| PubChem CID | 102052848 |
| Molecular Formula | C23H12Br2O3 |
| Molecular Weight | 496.15 g/mol |
| Exact Mass | 493.92 |
| IUPAC Name | 2',7'-dibromospiro[5,7-dihydrocyclopenta[f][2]benzofuran-6,9'-fluorene]-1,3-dione |
| SMILES | O=C1OC(=O)c2cc3c(cc21)CC1(C3)c2cc(Br)ccc2-c2ccc(Br)cc21 |
| InChI | InChI=1S/C23H12Br2O3/c24-13-1-3-15-16-4-2-14(25)8-20(16)23(19(15)7-13)9-11-5-17-18(6-12(11)10-23)22(27)28-21(17)26/h1-8H,9-10H2 |
| InChIKey | YAYDAQCQVDKKPS-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.15 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|