C52H36Br6N2 — CID 158934750
2-[3,4-bis(bromomethyl)phenyl]pyridine;2,7-dibromo-9H-fluorene;2-(2',7'-dibromospiro[1,3-dihydroindene-2,9'-fluorene]-5-yl)pyridine (PubChem CID 158934750) has the molecular formula C52H36Br6N2 and a molecular weight of 1168.30 g/mol. Its IUPAC name is 2-[3,4-bis(bromomethyl)phenyl]pyridine;2,7-dibromo-9H-fluorene;2-(2',7'-dibromospiro[1,3-dihydroindene-2,9'-fluorene]-5-yl)pyridine.
| Compound Name | 2-[3,4-bis(bromomethyl)phenyl]pyridine;2,7-dibromo-9H-fluorene;2-(2',7'-dibromospiro[1,3-dihydroindene-2,9'-fluorene]-5-yl)pyridine |
|---|---|
| PubChem CID | 158934750 |
| Molecular Formula | C52H36Br6N2 |
| Molecular Weight | 1168.30 g/mol |
| Exact Mass | 1161.80 |
| IUPAC Name | 2-[3,4-bis(bromomethyl)phenyl]pyridine;2,7-dibromo-9H-fluorene;2-(2',7'-dibromospiro[1,3-dihydroindene-2,9'-fluorene]-5-yl)pyridine |
| SMILES | BrCc1ccc(-c2ccccn2)cc1CBr.Brc1ccc2c(c1)C1(Cc3ccc(-c4ccccn4)cc3C1)c1cc(Br)ccc1-2.Brc1ccc2c(c1)Cc1cc(Br)ccc1-2 |
| InChI | InChI=1S/C26H17Br2N.C13H11Br2N.C13H8Br2/c27-19-6-8-21-22-9-7-20(28)13-24(22)26(23(21)12-19)14-17-5-4-16(11-18(17)15-26)25-3-1-2-10-29-25;14-8-11-5-4-10(7-12(11)9-15)13-3-1-2-6-16-13;14-10-1-3-12-8(6-10)5-9-7-11(15)2-4-13(9)12/h1-13H,14-15H2;1-7H,8-9H2;1-4,6-7H,5H2 |
| InChIKey | JJMWBSYUERVITK-UHFFFAOYSA-N |
| XLogP | 16.66 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1168.30 |
| LogP ≤ 5 | 16.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|