C12H9BrO3 — CID 56642761
(2S)-5-bromospiro[3H-indene-2,3'-oxolane]-1,2'-dione (PubChem CID 56642761) has the molecular formula C12H9BrO3 and a molecular weight of 281.10 g/mol. Its IUPAC name is (2S)-5-bromospiro[3H-indene-2,3'-oxolane]-1,2'-dione.
| Compound Name | (2S)-5-bromospiro[3H-indene-2,3'-oxolane]-1,2'-dione |
|---|---|
| PubChem CID | 56642761 |
| Molecular Formula | C12H9BrO3 |
| Molecular Weight | 281.10 g/mol |
| Exact Mass | 279.97 |
| IUPAC Name | (2S)-5-bromospiro[3H-indene-2,3'-oxolane]-1,2'-dione |
| SMILES | O=C1OCC[C@]12Cc1cc(Br)ccc1C2=O |
| InChI | InChI=1S/C12H9BrO3/c13-8-1-2-9-7(5-8)6-12(10(9)14)3-4-16-11(12)15/h1-2,5H,3-4,6H2/t12-/m1/s1 |
| InChIKey | XSCFPQBVLLNGPK-GFCCVEGCSA-N |
| XLogP | 2.12 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.10 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|