C13H11BrO — CID 155929540
5-bromospiro[3H-indene-2,4'-cyclopentene]-1-one (PubChem CID 155929540) has the molecular formula C13H11BrO and a molecular weight of 263.13 g/mol. Its IUPAC name is 5-bromospiro[3H-indene-2,4'-cyclopentene]-1-one.
| Compound Name | 5-bromospiro[3H-indene-2,4'-cyclopentene]-1-one |
|---|---|
| PubChem CID | 155929540 |
| Molecular Formula | C13H11BrO |
| Molecular Weight | 263.13 g/mol |
| Exact Mass | 262.00 |
| IUPAC Name | 5-bromospiro[3H-indene-2,4'-cyclopentene]-1-one |
| SMILES | O=C1c2ccc(Br)cc2CC12CC=CC2 |
| InChI | InChI=1S/C13H11BrO/c14-10-3-4-11-9(7-10)8-13(12(11)15)5-1-2-6-13/h1-4,7H,5-6,8H2 |
| InChIKey | CKKTWFSCQOUZKW-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.13 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|