C16H8Br2N2O5 — CID 159055107
5-bromo-2-benzofuran-1,3-dione;6-bromo-2,3-dihydrophthalazine-1,4-dione (PubChem CID 159055107) has the molecular formula C16H8Br2N2O5 and a molecular weight of 468.06 g/mol. Its IUPAC name is 5-bromo-2-benzofuran-1,3-dione;6-bromo-2,3-dihydrophthalazine-1,4-dione.
| Compound Name | 5-bromo-2-benzofuran-1,3-dione;6-bromo-2,3-dihydrophthalazine-1,4-dione |
|---|---|
| PubChem CID | 159055107 |
| Molecular Formula | C16H8Br2N2O5 |
| Molecular Weight | 468.06 g/mol |
| Exact Mass | 465.88 |
| IUPAC Name | 5-bromo-2-benzofuran-1,3-dione;6-bromo-2,3-dihydrophthalazine-1,4-dione |
| SMILES | O=C1OC(=O)c2cc(Br)ccc21.O=c1[nH][nH]c(=O)c2cc(Br)ccc12 |
| InChI | InChI=1S/C8H5BrN2O2.C8H3BrO3/c9-4-1-2-5-6(3-4)8(13)11-10-7(5)12;9-4-1-2-5-6(3-4)8(11)12-7(5)10/h1-3H,(H,10,12)(H,11,13);1-3H |
| InChIKey | JXTIWWMZFJEWBC-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 109.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.06 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|