C11H7BrO4 — CID 76563370
6-bromo-4-(methoxymethylidene)isochromene-1,3-dione (PubChem CID 76563370) has the molecular formula C11H7BrO4 and a molecular weight of 283.08 g/mol. Its IUPAC name is 6-bromo-4-(methoxymethylidene)isochromene-1,3-dione.
| Compound Name | 6-bromo-4-(methoxymethylidene)isochromene-1,3-dione |
|---|---|
| PubChem CID | 76563370 |
| Molecular Formula | C11H7BrO4 |
| Molecular Weight | 283.08 g/mol |
| Exact Mass | 281.95 |
| IUPAC Name | 6-bromo-4-(methoxymethylidene)isochromene-1,3-dione |
| SMILES | COC=C1C(=O)OC(=O)c2ccc(Br)cc21 |
| InChI | InChI=1S/C11H7BrO4/c1-15-5-9-8-4-6(12)2-3-7(8)10(13)16-11(9)14/h2-5H,1H3 |
| InChIKey | QWQUCKSNGHAYNA-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.08 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|