C12H11BrO3 — CID 82249490
(4Z)-8-bromo-4-(methoxymethylidene)-2,3-dihydro-1-benzoxepin-5-one (PubChem CID 82249490) has the molecular formula C12H11BrO3 and a molecular weight of 283.12 g/mol. Its IUPAC name is (4Z)-8-bromo-4-(methoxymethylidene)-2,3-dihydro-1-benzoxepin-5-one.
| Compound Name | (4Z)-8-bromo-4-(methoxymethylidene)-2,3-dihydro-1-benzoxepin-5-one |
|---|---|
| PubChem CID | 82249490 |
| Molecular Formula | C12H11BrO3 |
| Molecular Weight | 283.12 g/mol |
| Exact Mass | 281.99 |
| IUPAC Name | (4Z)-8-bromo-4-(methoxymethylidene)-2,3-dihydro-1-benzoxepin-5-one |
| SMILES | CO/C=C1/CCOc2cc(Br)ccc2C1=O |
| InChI | InChI=1S/C12H11BrO3/c1-15-7-8-4-5-16-11-6-9(13)2-3-10(11)12(8)14/h2-3,6-7H,4-5H2,1H3/b8-7- |
| InChIKey | DGIVCOUMXQLXJP-FPLPWBNLSA-N |
| XLogP | 2.94 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.12 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|