C13H9BrN2O2S — CID 51083773
(4E)-8-bromo-4-(thiadiazol-4-ylmethylidene)-2,3-dihydro-1-benzoxepin-5-one (PubChem CID 51083773) has the molecular formula C13H9BrN2O2S and a molecular weight of 337.20 g/mol. Its IUPAC name is (4E)-8-bromo-4-(thiadiazol-4-ylmethylidene)-2,3-dihydro-1-benzoxepin-5-one.
| Compound Name | (4E)-8-bromo-4-(thiadiazol-4-ylmethylidene)-2,3-dihydro-1-benzoxepin-5-one |
|---|---|
| PubChem CID | 51083773 |
| Molecular Formula | C13H9BrN2O2S |
| Molecular Weight | 337.20 g/mol |
| Exact Mass | 335.96 |
| IUPAC Name | (4E)-8-bromo-4-(thiadiazol-4-ylmethylidene)-2,3-dihydro-1-benzoxepin-5-one |
| SMILES | O=C1/C(=C/c2csnn2)CCOc2cc(Br)ccc21 |
| InChI | InChI=1S/C13H9BrN2O2S/c14-9-1-2-11-12(6-9)18-4-3-8(13(11)17)5-10-7-19-16-15-10/h1-2,5-7H,3-4H2/b8-5+ |
| InChIKey | HAXTYIGIWAMBOZ-VMPITWQZSA-N |
| XLogP | 3.35 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.20 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|