C14H10F2N2OS2 — CID 75406987
(2E)-6-(difluoromethylsulfanyl)-2-(thiadiazol-4-ylmethylidene)-3,4-dihydronaphthalen-1-one (PubChem CID 75406987) has the molecular formula C14H10F2N2OS2 and a molecular weight of 324.38 g/mol. Its IUPAC name is (2E)-6-(difluoromethylsulfanyl)-2-(thiadiazol-4-ylmethylidene)-3,4-dihydronaphthalen-1-one.
| Compound Name | (2E)-6-(difluoromethylsulfanyl)-2-(thiadiazol-4-ylmethylidene)-3,4-dihydronaphthalen-1-one |
|---|---|
| PubChem CID | 75406987 |
| Molecular Formula | C14H10F2N2OS2 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.02 |
| IUPAC Name | (2E)-6-(difluoromethylsulfanyl)-2-(thiadiazol-4-ylmethylidene)-3,4-dihydronaphthalen-1-one |
| SMILES | O=C1/C(=C/c2csnn2)CCc2cc(SC(F)F)ccc21 |
| InChI | InChI=1S/C14H10F2N2OS2/c15-14(16)21-11-3-4-12-8(6-11)1-2-9(13(12)19)5-10-7-20-18-17-10/h3-7,14H,1-2H2/b9-5+ |
| InChIKey | OXTPRZIBRAICTP-WEVVVXLNSA-N |
| XLogP | 4.07 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|