C17H15NO3S — CID 66722648
methyl 6-[(2-methyl-1,3-thiazol-5-yl)methylidene]-5-oxo-7,8-dihydronaphthalene-2-carboxylate (PubChem CID 66722648) has the molecular formula C17H15NO3S and a molecular weight of 313.38 g/mol. Its IUPAC name is methyl 6-[(2-methyl-1,3-thiazol-5-yl)methylidene]-5-oxo-7,8-dihydronaphthalene-2-carboxylate.
| Compound Name | methyl 6-[(2-methyl-1,3-thiazol-5-yl)methylidene]-5-oxo-7,8-dihydronaphthalene-2-carboxylate |
|---|---|
| PubChem CID | 66722648 |
| Molecular Formula | C17H15NO3S |
| Molecular Weight | 313.38 g/mol |
| Exact Mass | 313.08 |
| IUPAC Name | methyl 6-[(2-methyl-1,3-thiazol-5-yl)methylidene]-5-oxo-7,8-dihydronaphthalene-2-carboxylate |
| SMILES | COC(=O)c1ccc2c(c1)CCC(=Cc1cnc(C)s1)C2=O |
| InChI | InChI=1S/C17H15NO3S/c1-10-18-9-14(22-10)8-12-4-3-11-7-13(17(20)21-2)5-6-15(11)16(12)19/h5-9H,3-4H2,1-2H3 |
| InChIKey | HRXGELJGOLWOGJ-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.38 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|