C17H12F2O2 — CID 72689051
2-[(2,3-difluorophenyl)methylidene]-6-hydroxy-3,4-dihydronaphthalen-1-one (PubChem CID 72689051) has the molecular formula C17H12F2O2 and a molecular weight of 286.28 g/mol. Its IUPAC name is 2-[(2,3-difluorophenyl)methylidene]-6-hydroxy-3,4-dihydronaphthalen-1-one.
| Compound Name | 2-[(2,3-difluorophenyl)methylidene]-6-hydroxy-3,4-dihydronaphthalen-1-one |
|---|---|
| PubChem CID | 72689051 |
| Molecular Formula | C17H12F2O2 |
| Molecular Weight | 286.28 g/mol |
| Exact Mass | 286.08 |
| IUPAC Name | 2-[(2,3-difluorophenyl)methylidene]-6-hydroxy-3,4-dihydronaphthalen-1-one |
| SMILES | O=C1C(=Cc2cccc(F)c2F)CCc2cc(O)ccc21 |
| InChI | InChI=1S/C17H12F2O2/c18-15-3-1-2-11(16(15)19)8-12-5-4-10-9-13(20)6-7-14(10)17(12)21/h1-3,6-9,20H,4-5H2 |
| InChIKey | PWLSQYGCQKPAEO-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.28 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|