C23H18O2 — CID 11595033
(2E)-6-hydroxy-2-[(4-phenylphenyl)methylidene]-3,4-dihydronaphthalen-1-one (PubChem CID 11595033) has the molecular formula C23H18O2 and a molecular weight of 326.40 g/mol. Its IUPAC name is (2E)-6-hydroxy-2-[(4-phenylphenyl)methylidene]-3,4-dihydronaphthalen-1-one.
| Compound Name | (2E)-6-hydroxy-2-[(4-phenylphenyl)methylidene]-3,4-dihydronaphthalen-1-one |
|---|---|
| PubChem CID | 11595033 |
| Molecular Formula | C23H18O2 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | (2E)-6-hydroxy-2-[(4-phenylphenyl)methylidene]-3,4-dihydronaphthalen-1-one |
| SMILES | O=C1/C(=C/c2ccc(-c3ccccc3)cc2)CCc2cc(O)ccc21 |
| InChI | InChI=1S/C23H18O2/c24-21-12-13-22-19(15-21)10-11-20(23(22)25)14-16-6-8-18(9-7-16)17-4-2-1-3-5-17/h1-9,12-15,24H,10-11H2/b20-14+ |
| InChIKey | NIBJMTYORMTMOV-XSFVSMFZSA-N |
| XLogP | 5.27 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|