C15H13BrN2O2 — CID 134024255
(4Z)-8-bromo-4-[(1-methylpyrazol-4-yl)methylidene]-2,3-dihydro-1-benzoxepin-5-one (PubChem CID 134024255) has the molecular formula C15H13BrN2O2 and a molecular weight of 333.19 g/mol. Its IUPAC name is (4Z)-8-bromo-4-[(1-methylpyrazol-4-yl)methylidene]-2,3-dihydro-1-benzoxepin-5-one.
| Compound Name | (4Z)-8-bromo-4-[(1-methylpyrazol-4-yl)methylidene]-2,3-dihydro-1-benzoxepin-5-one |
|---|---|
| PubChem CID | 134024255 |
| Molecular Formula | C15H13BrN2O2 |
| Molecular Weight | 333.19 g/mol |
| Exact Mass | 332.02 |
| IUPAC Name | (4Z)-8-bromo-4-[(1-methylpyrazol-4-yl)methylidene]-2,3-dihydro-1-benzoxepin-5-one |
| SMILES | Cn1cc(/C=C2/CCOc3cc(Br)ccc3C2=O)cn1 |
| InChI | InChI=1S/C15H13BrN2O2/c1-18-9-10(8-17-18)6-11-4-5-20-14-7-12(16)2-3-13(14)15(11)19/h2-3,6-9H,4-5H2,1H3/b11-6- |
| InChIKey | PYBUKEAPTFIENV-WDZFZDKYSA-N |
| XLogP | 3.23 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.19 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|