C13H12N2OS — CID 75407019
(5E)-5-[(1-methylpyrazol-4-yl)methylidene]-6,7-dihydro-1-benzothiophen-4-one (PubChem CID 75407019) has the molecular formula C13H12N2OS and a molecular weight of 244.32 g/mol. Its IUPAC name is (5E)-5-[(1-methylpyrazol-4-yl)methylidene]-6,7-dihydro-1-benzothiophen-4-one.
| Compound Name | (5E)-5-[(1-methylpyrazol-4-yl)methylidene]-6,7-dihydro-1-benzothiophen-4-one |
|---|---|
| PubChem CID | 75407019 |
| Molecular Formula | C13H12N2OS |
| Molecular Weight | 244.32 g/mol |
| Exact Mass | 244.07 |
| IUPAC Name | (5E)-5-[(1-methylpyrazol-4-yl)methylidene]-6,7-dihydro-1-benzothiophen-4-one |
| SMILES | Cn1cc(/C=C2\CCc3sccc3C2=O)cn1 |
| InChI | InChI=1S/C13H12N2OS/c1-15-8-9(7-14-15)6-10-2-3-12-11(13(10)16)4-5-17-12/h4-8H,2-3H2,1H3/b10-6+ |
| InChIKey | WFPRFMKXIDKUFH-UXBLZVDNSA-N |
| XLogP | 2.69 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.32 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|