C15H16N4O — CID 6211073
(2E,5E)-2,5-bis[(1-methylpyrazol-4-yl)methylidene]cyclopentan-1-one (PubChem CID 6211073) has the molecular formula C15H16N4O and a molecular weight of 268.32 g/mol. Its IUPAC name is (2E,5E)-2,5-bis[(1-methylpyrazol-4-yl)methylidene]cyclopentan-1-one.
| Compound Name | (2E,5E)-2,5-bis[(1-methylpyrazol-4-yl)methylidene]cyclopentan-1-one |
|---|---|
| PubChem CID | 6211073 |
| Molecular Formula | C15H16N4O |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | (2E,5E)-2,5-bis[(1-methylpyrazol-4-yl)methylidene]cyclopentan-1-one |
| SMILES | Cn1cc(/C=C2\CC/C(=C\c3cnn(C)c3)C2=O)cn1 |
| InChI | InChI=1S/C15H16N4O/c1-18-9-11(7-16-18)5-13-3-4-14(15(13)20)6-12-8-17-19(2)10-12/h5-10H,3-4H2,1-2H3/b13-5+,14-6+ |
| InChIKey | UWLUQURHVFLEMQ-ACFHMISVSA-N |
| XLogP | 1.98 |
| TPSA | 52.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|