C21H28N4O — CID 102594123
4-(2-methylbutan-2-yl)-2,6-bis[(1-methylpyrazol-4-yl)methylidene]cyclohexan-1-one (PubChem CID 102594123) has the molecular formula C21H28N4O and a molecular weight of 352.48 g/mol. Its IUPAC name is 4-(2-methylbutan-2-yl)-2,6-bis[(1-methylpyrazol-4-yl)methylidene]cyclohexan-1-one.
| Compound Name | 4-(2-methylbutan-2-yl)-2,6-bis[(1-methylpyrazol-4-yl)methylidene]cyclohexan-1-one |
|---|---|
| PubChem CID | 102594123 |
| Molecular Formula | C21H28N4O |
| Molecular Weight | 352.48 g/mol |
| Exact Mass | 352.23 |
| IUPAC Name | 4-(2-methylbutan-2-yl)-2,6-bis[(1-methylpyrazol-4-yl)methylidene]cyclohexan-1-one |
| SMILES | CCC(C)(C)C1CC(=Cc2cnn(C)c2)C(=O)C(=Cc2cnn(C)c2)C1 |
| InChI | InChI=1S/C21H28N4O/c1-6-21(2,3)19-9-17(7-15-11-22-24(4)13-15)20(26)18(10-19)8-16-12-23-25(5)14-16/h7-8,11-14,19H,6,9-10H2,1-5H3 |
| InChIKey | OOKHDJDBMLVJQA-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 52.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.48 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|