C22H28Cl2N4O — CID 72685320
4-tert-butyl-2,6-bis[[1-(2-chloroethyl)pyrazol-4-yl]methylidene]cyclohexan-1-one (PubChem CID 72685320) has the molecular formula C22H28Cl2N4O and a molecular weight of 435.40 g/mol. Its IUPAC name is 4-tert-butyl-2,6-bis[[1-(2-chloroethyl)pyrazol-4-yl]methylidene]cyclohexan-1-one.
| Compound Name | 4-tert-butyl-2,6-bis[[1-(2-chloroethyl)pyrazol-4-yl]methylidene]cyclohexan-1-one |
|---|---|
| PubChem CID | 72685320 |
| Molecular Formula | C22H28Cl2N4O |
| Molecular Weight | 435.40 g/mol |
| Exact Mass | 434.16 |
| IUPAC Name | 4-tert-butyl-2,6-bis[[1-(2-chloroethyl)pyrazol-4-yl]methylidene]cyclohexan-1-one |
| SMILES | CC(C)(C)C1CC(=Cc2cnn(CCCl)c2)C(=O)C(=Cc2cnn(CCCl)c2)C1 |
| InChI | InChI=1S/C22H28Cl2N4O/c1-22(2,3)20-10-18(8-16-12-25-27(14-16)6-4-23)21(29)19(11-20)9-17-13-26-28(15-17)7-5-24/h8-9,12-15,20H,4-7,10-11H2,1-3H3 |
| InChIKey | JPFYZZOARXSKDK-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 52.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.40 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|