C18H13BrO4 — CID 31316325
4-[(E)-(8-bromo-5-oxo-2,3-dihydro-1-benzoxepin-4-ylidene)methyl]benzoic acid (PubChem CID 31316325) has the molecular formula C18H13BrO4 and a molecular weight of 373.20 g/mol. Its IUPAC name is 4-[(E)-(8-bromo-5-oxo-2,3-dihydro-1-benzoxepin-4-ylidene)methyl]benzoic acid.
| Compound Name | 4-[(E)-(8-bromo-5-oxo-2,3-dihydro-1-benzoxepin-4-ylidene)methyl]benzoic acid |
|---|---|
| PubChem CID | 31316325 |
| Molecular Formula | C18H13BrO4 |
| Molecular Weight | 373.20 g/mol |
| Exact Mass | 372.00 |
| IUPAC Name | 4-[(E)-(8-bromo-5-oxo-2,3-dihydro-1-benzoxepin-4-ylidene)methyl]benzoic acid |
| SMILES | O=C(O)c1ccc(/C=C2\CCOc3cc(Br)ccc3C2=O)cc1 |
| InChI | InChI=1S/C18H13BrO4/c19-14-5-6-15-16(10-14)23-8-7-13(17(15)20)9-11-1-3-12(4-2-11)18(21)22/h1-6,9-10H,7-8H2,(H,21,22)/b13-9+ |
| InChIKey | DXXKMUIMVBGDPB-UKTHLTGXSA-N |
| XLogP | 4.20 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.20 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|