C21H14Br2O5 — CID 141291724
3-bromo-4-[[3-[(2-bromo-4-carboxyphenyl)methylidene]-2-oxocyclopentylidene]methyl]benzoic acid (PubChem CID 141291724) has the molecular formula C21H14Br2O5 and a molecular weight of 506.15 g/mol. Its IUPAC name is 3-bromo-4-[[3-[(2-bromo-4-carboxyphenyl)methylidene]-2-oxocyclopentylidene]methyl]benzoic acid.
| Compound Name | 3-bromo-4-[[3-[(2-bromo-4-carboxyphenyl)methylidene]-2-oxocyclopentylidene]methyl]benzoic acid |
|---|---|
| PubChem CID | 141291724 |
| Molecular Formula | C21H14Br2O5 |
| Molecular Weight | 506.15 g/mol |
| Exact Mass | 503.92 |
| IUPAC Name | 3-bromo-4-[[3-[(2-bromo-4-carboxyphenyl)methylidene]-2-oxocyclopentylidene]methyl]benzoic acid |
| SMILES | O=C1C(=Cc2ccc(C(=O)O)cc2Br)CCC1=Cc1ccc(C(=O)O)cc1Br |
| InChI | InChI=1S/C21H14Br2O5/c22-17-9-15(20(25)26)5-1-11(17)7-13-3-4-14(19(13)24)8-12-2-6-16(21(27)28)10-18(12)23/h1-2,5-10H,3-4H2,(H,25,26)(H,27,28) |
| InChIKey | UNRJFOOGDZIOLU-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.15 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|