C18H13ClO3 — CID 175422904
7-[(4-chlorophenyl)methylidene]-8-oxo-5,6-dihydronaphthalene-2-carboxylic acid (PubChem CID 175422904) has the molecular formula C18H13ClO3 and a molecular weight of 312.75 g/mol. Its IUPAC name is 7-[(4-chlorophenyl)methylidene]-8-oxo-5,6-dihydronaphthalene-2-carboxylic acid.
| Compound Name | 7-[(4-chlorophenyl)methylidene]-8-oxo-5,6-dihydronaphthalene-2-carboxylic acid |
|---|---|
| PubChem CID | 175422904 |
| Molecular Formula | C18H13ClO3 |
| Molecular Weight | 312.75 g/mol |
| Exact Mass | 312.06 |
| IUPAC Name | 7-[(4-chlorophenyl)methylidene]-8-oxo-5,6-dihydronaphthalene-2-carboxylic acid |
| SMILES | O=C(O)c1ccc2c(c1)C(=O)C(=Cc1ccc(Cl)cc1)CC2 |
| InChI | InChI=1S/C18H13ClO3/c19-15-7-1-11(2-8-15)9-13-5-3-12-4-6-14(18(21)22)10-16(12)17(13)20/h1-2,4,6-10H,3,5H2,(H,21,22) |
| InChIKey | YNZWULMINYVYGW-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.75 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|