C20H16O4 — CID 91943133
4-[(4-oxospiro[chromene-2,1'-cyclobutane]-3-ylidene)methyl]benzoic acid (PubChem CID 91943133) has the molecular formula C20H16O4 and a molecular weight of 320.34 g/mol. Its IUPAC name is 4-[(4-oxospiro[chromene-2,1'-cyclobutane]-3-ylidene)methyl]benzoic acid.
| Compound Name | 4-[(4-oxospiro[chromene-2,1'-cyclobutane]-3-ylidene)methyl]benzoic acid |
|---|---|
| PubChem CID | 91943133 |
| Molecular Formula | C20H16O4 |
| Molecular Weight | 320.34 g/mol |
| Exact Mass | 320.10 |
| IUPAC Name | 4-[(4-oxospiro[chromene-2,1'-cyclobutane]-3-ylidene)methyl]benzoic acid |
| SMILES | O=C(O)c1ccc(C=C2C(=O)c3ccccc3OC23CCC3)cc1 |
| InChI | InChI=1S/C20H16O4/c21-18-15-4-1-2-5-17(15)24-20(10-3-11-20)16(18)12-13-6-8-14(9-7-13)19(22)23/h1-2,4-9,12H,3,10-11H2,(H,22,23) |
| InChIKey | FLYJAQNLVKXGEW-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.34 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|