C11H8BrNO3 — CID 166480292
6-bromospiro[isoquinoline-4,3'-oxetane]-1,3-dione (PubChem CID 166480292) has the molecular formula C11H8BrNO3 and a molecular weight of 282.09 g/mol. Its IUPAC name is 6-bromospiro[isoquinoline-4,3'-oxetane]-1,3-dione.
| Compound Name | 6-bromospiro[isoquinoline-4,3'-oxetane]-1,3-dione |
|---|---|
| PubChem CID | 166480292 |
| Molecular Formula | C11H8BrNO3 |
| Molecular Weight | 282.09 g/mol |
| Exact Mass | 280.97 |
| IUPAC Name | 6-bromospiro[isoquinoline-4,3'-oxetane]-1,3-dione |
| SMILES | O=C1NC(=O)C2(COC2)c2cc(Br)ccc21 |
| InChI | InChI=1S/C11H8BrNO3/c12-6-1-2-7-8(3-6)11(4-16-5-11)10(15)13-9(7)14/h1-3H,4-5H2,(H,13,14,15) |
| InChIKey | AIGRHAZHCVYBRS-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.09 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|