C13H14BrNO2 — CID 171798154
5-bromo-2-methylspiro[isoindole-3,4'-oxane]-1-one (PubChem CID 171798154) has the molecular formula C13H14BrNO2 and a molecular weight of 296.16 g/mol. Its IUPAC name is 5-bromo-2-methylspiro[isoindole-3,4'-oxane]-1-one.
| Compound Name | 5-bromo-2-methylspiro[isoindole-3,4'-oxane]-1-one |
|---|---|
| PubChem CID | 171798154 |
| Molecular Formula | C13H14BrNO2 |
| Molecular Weight | 296.16 g/mol |
| Exact Mass | 295.02 |
| IUPAC Name | 5-bromo-2-methylspiro[isoindole-3,4'-oxane]-1-one |
| SMILES | CN1C(=O)c2ccc(Br)cc2C12CCOCC2 |
| InChI | InChI=1S/C13H14BrNO2/c1-15-12(16)10-3-2-9(14)8-11(10)13(15)4-6-17-7-5-13/h2-3,8H,4-7H2,1H3 |
| InChIKey | HIARLLRIYBKRRC-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.16 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |