C11H14BrN — CID 84728033
(6-bromo-1-methyl-2,3-dihydroinden-1-yl)methanamine (PubChem CID 84728033) has the molecular formula C11H14BrN and a molecular weight of 240.14 g/mol. Its IUPAC name is (6-bromo-1-methyl-2,3-dihydroinden-1-yl)methanamine.
| Compound Name | (6-bromo-1-methyl-2,3-dihydroinden-1-yl)methanamine |
|---|---|
| PubChem CID | 84728033 |
| Molecular Formula | C11H14BrN |
| Molecular Weight | 240.14 g/mol |
| Exact Mass | 239.03 |
| IUPAC Name | (6-bromo-1-methyl-2,3-dihydroinden-1-yl)methanamine |
| SMILES | CC1(CN)CCc2ccc(Br)cc21 |
| InChI | InChI=1S/C11H14BrN/c1-11(7-13)5-4-8-2-3-9(12)6-10(8)11/h2-3,6H,4-5,7,13H2,1H3 |
| InChIKey | CDTSBXAIEMGPMV-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.14 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |