C14H16N2 — CID 141172300
spiro[1,2-dihydroindole-3,1'-cyclohexane]-5-carbonitrile (PubChem CID 141172300) has the molecular formula C14H16N2 and a molecular weight of 212.30 g/mol. Its IUPAC name is spiro[1,2-dihydroindole-3,1'-cyclohexane]-5-carbonitrile.
| Compound Name | spiro[1,2-dihydroindole-3,1'-cyclohexane]-5-carbonitrile |
|---|---|
| PubChem CID | 141172300 |
| Molecular Formula | C14H16N2 |
| Molecular Weight | 212.30 g/mol |
| Exact Mass | 212.13 |
| IUPAC Name | spiro[1,2-dihydroindole-3,1'-cyclohexane]-5-carbonitrile |
| SMILES | N#Cc1ccc2c(c1)C1(CCCCC1)CN2 |
| InChI | InChI=1S/C14H16N2/c15-9-11-4-5-13-12(8-11)14(10-16-13)6-2-1-3-7-14/h4-5,8,16H,1-3,6-7,10H2 |
| InChIKey | ZASSYIKFSSPCLR-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.30 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |