C14H19NO2S — CID 168726724
5-methylsulfonylspiro[1,2-dihydroindole-3,1'-cyclohexane] (PubChem CID 168726724) has the molecular formula C14H19NO2S and a molecular weight of 265.38 g/mol. Its IUPAC name is 5-methylsulfonylspiro[1,2-dihydroindole-3,1'-cyclohexane].
| Compound Name | 5-methylsulfonylspiro[1,2-dihydroindole-3,1'-cyclohexane] |
|---|---|
| PubChem CID | 168726724 |
| Molecular Formula | C14H19NO2S |
| Molecular Weight | 265.38 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | 5-methylsulfonylspiro[1,2-dihydroindole-3,1'-cyclohexane] |
| SMILES | CS(=O)(=O)c1ccc2c(c1)C1(CCCCC1)CN2 |
| InChI | InChI=1S/C14H19NO2S/c1-18(16,17)11-5-6-13-12(9-11)14(10-15-13)7-3-2-4-8-14/h5-6,9,15H,2-4,7-8,10H2,1H3 |
| InChIKey | VEIPAPRRXJZCIO-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.38 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |