C12H17NO3S — CID 117391526
2-(1-aminocyclopentyl)-5-methylsulfonylphenol (PubChem CID 117391526) has the molecular formula C12H17NO3S and a molecular weight of 255.34 g/mol. Its IUPAC name is 2-(1-aminocyclopentyl)-5-methylsulfonylphenol.
| Compound Name | 2-(1-aminocyclopentyl)-5-methylsulfonylphenol |
|---|---|
| PubChem CID | 117391526 |
| Molecular Formula | C12H17NO3S |
| Molecular Weight | 255.34 g/mol |
| Exact Mass | 255.09 |
| IUPAC Name | 2-(1-aminocyclopentyl)-5-methylsulfonylphenol |
| SMILES | CS(=O)(=O)c1ccc(C2(N)CCCC2)c(O)c1 |
| InChI | InChI=1S/C12H17NO3S/c1-17(15,16)9-4-5-10(11(14)8-9)12(13)6-2-3-7-12/h4-5,8,14H,2-3,6-7,13H2,1H3 |
| InChIKey | WRYKIHCGMUAFHT-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.34 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|