About 5-fluorospiro[1,2-dihydroisoindole-3,1'-cyclopropane]
5-fluorospiro[1,2-dihydroisoindole-3,1'-cyclopropane] (PubChem CID 115012818) has the molecular formula C10H10FN
and a molecular weight of 163.19 g/mol. Its IUPAC name is 5-fluorospiro[1,2-dihydroisoindole-3,1'-cyclopropane].
Analyze 5-fluorospiro[1,2-dihydroisoindole-3,1'-cyclopropane] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluorospiro[1,2-dihydroisoindole-3,1'-cyclopropane]?
The IUPAC name of 5-fluorospiro[1,2-dihydroisoindole-3,1'-cyclopropane] (CID 115012818) is 5-fluorospiro[1,2-dihydroisoindole-3,1'-cyclopropane].
What is the SMILES notation for 5-fluorospiro[1,2-dihydroisoindole-3,1'-cyclopropane]?
The canonical SMILES for 5-fluorospiro[1,2-dihydroisoindole-3,1'-cyclopropane] is Fc1ccc2c(c1)C1(CC1)NC2.
What is the InChIKey of 5-fluorospiro[1,2-dihydroisoindole-3,1'-cyclopropane]?
The InChIKey is NEZYYUVBFWWFHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10FN/c11-8-2-1-7-6-12-10(3-4-10)9(7)5-8/h1-2,5,12H,3-4,6H2.
What are the key properties of 5-fluorospiro[1,2-dihydroisoindole-3,1'-cyclopropane]?
5-fluorospiro[1,2-dihydroisoindole-3,1'-cyclopropane] has a molecular weight of 163.19 g/mol, XLogP of 1.92, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluorospiro[1,2-dihydroisoindole-3,1'-cyclopropane] is sourced from PubChem (CID 115012818), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).