C15H22 — CID 144809006
3,6-dimethyl-1,2-dihydronaphthalene;propane (PubChem CID 144809006) has the molecular formula C15H22 and a molecular weight of 202.34 g/mol. Its IUPAC name is 3,6-dimethyl-1,2-dihydronaphthalene;propane.
| Compound Name | 3,6-dimethyl-1,2-dihydronaphthalene;propane |
|---|---|
| PubChem CID | 144809006 |
| Molecular Formula | C15H22 |
| Molecular Weight | 202.34 g/mol |
| Exact Mass | 202.17 |
| IUPAC Name | 3,6-dimethyl-1,2-dihydronaphthalene;propane |
| SMILES | CC1=Cc2cc(C)ccc2CC1.CCC |
| InChI | InChI=1S/C12H14.C3H8/c1-9-3-5-11-6-4-10(2)8-12(11)7-9;1-3-2/h3,5,7-8H,4,6H2,1-2H3;3H2,1-2H3 |
| InChIKey | JRVWNGCIINLVFV-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.34 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |