About 1-buta-1,3-dienylpyrrolidin-2-one;thiophene
1-buta-1,3-dienylpyrrolidin-2-one;thiophene (PubChem CID 175032170) has the molecular formula C12H15NOS
and a molecular weight of 221.33 g/mol. Its IUPAC name is 1-buta-1,3-dienylpyrrolidin-2-one;thiophene.
Molecular Properties
| Compound Name | 1-buta-1,3-dienylpyrrolidin-2-one;thiophene |
| PubChem CID | 175032170 |
| Molecular Formula | C12H15NOS |
| Molecular Weight | 221.33 g/mol |
| Exact Mass | 221.09 |
| IUPAC Name | 1-buta-1,3-dienylpyrrolidin-2-one;thiophene |
| SMILES | C=CC=CN1CCCC1=O.c1ccsc1 |
| InChI | InChI=1S/C8H11NO.C4H4S/c1-2-3-6-9-7-4-5-8(9)10;1-2-4-5-3-1/h2-3,6H,1,4-5,7H2;1-4H |
| InChIKey | YDKMZMQJXRNUMP-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.33 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1-buta-1,3-dienylpyrrolidin-2-one;thiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-buta-1,3-dienylpyrrolidin-2-one;thiophene?
The IUPAC name of 1-buta-1,3-dienylpyrrolidin-2-one;thiophene (CID 175032170) is 1-buta-1,3-dienylpyrrolidin-2-one;thiophene.
What is the SMILES notation for 1-buta-1,3-dienylpyrrolidin-2-one;thiophene?
The canonical SMILES for 1-buta-1,3-dienylpyrrolidin-2-one;thiophene is C=CC=CN1CCCC1=O.c1ccsc1.
What is the InChIKey of 1-buta-1,3-dienylpyrrolidin-2-one;thiophene?
The InChIKey is YDKMZMQJXRNUMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11NO.C4H4S/c1-2-3-6-9-7-4-5-8(9)10;1-2-4-5-3-1/h2-3,6H,1,4-5,7H2;1-4H.
What are the key properties of 1-buta-1,3-dienylpyrrolidin-2-one;thiophene?
1-buta-1,3-dienylpyrrolidin-2-one;thiophene has a molecular weight of 221.33 g/mol, XLogP of 3.06, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-buta-1,3-dienylpyrrolidin-2-one;thiophene is sourced from PubChem (CID 175032170), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).