C12H15NOS — CID 175032170
1-buta-1,3-dienylpyrrolidin-2-one;thiophene (PubChem CID 175032170) has the molecular formula C12H15NOS and a molecular weight of 221.33 g/mol. Its IUPAC name is 1-buta-1,3-dienylpyrrolidin-2-one;thiophene.
| Compound Name | 1-buta-1,3-dienylpyrrolidin-2-one;thiophene |
|---|---|
| PubChem CID | 175032170 |
| Molecular Formula | C12H15NOS |
| Molecular Weight | 221.33 g/mol |
| Exact Mass | 221.09 |
| IUPAC Name | 1-buta-1,3-dienylpyrrolidin-2-one;thiophene |
| SMILES | C=CC=CN1CCCC1=O.c1ccsc1 |
| InChI | InChI=1S/C8H11NO.C4H4S/c1-2-3-6-9-7-4-5-8(9)10;1-2-4-5-3-1/h2-3,6H,1,4-5,7H2;1-4H |
| InChIKey | YDKMZMQJXRNUMP-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.33 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|