C9H13NO — CID 170549947
1-penta-1,3-dienylpyrrolidin-2-one (PubChem CID 170549947) has the molecular formula C9H13NO and a molecular weight of 151.21 g/mol. Its IUPAC name is 1-penta-1,3-dienylpyrrolidin-2-one.
| Compound Name | 1-penta-1,3-dienylpyrrolidin-2-one |
|---|---|
| PubChem CID | 170549947 |
| Molecular Formula | C9H13NO |
| Molecular Weight | 151.21 g/mol |
| Exact Mass | 151.10 |
| IUPAC Name | 1-penta-1,3-dienylpyrrolidin-2-one |
| SMILES | CC=CC=CN1CCCC1=O |
| InChI | InChI=1S/C9H13NO/c1-2-3-4-7-10-8-5-6-9(10)11/h2-4,7H,5-6,8H2,1H3 |
| InChIKey | IEYZCARKWGHPHC-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.21 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|