acetic acid;1-(2-hydroperoxyethenyl)pyrrolidin-2-one

C8H13NO5 — CID 173024590

IUPACacetic acid;1-(2-hydroperoxyethenyl)pyrrolidin-2-one
SMILESCC(=O)O.O=C1CCCN1C=COO
InChIInChI=1S/C6H9NO3.C2H4O2/c8-6-2-1-3-7(6)4-5-10-9;1-2(3)4/h4-5,9H,1-3H2;1H3,(H,3,4)
InChIKeyIFSSVEOVBITOND-UHFFFAOYSA-N
MW203.19 g/mol
LogP0.66
Rot. Bonds2

About acetic acid;1-(2-hydroperoxyethenyl)pyrrolidin-2-one

acetic acid;1-(2-hydroperoxyethenyl)pyrrolidin-2-one (PubChem CID 173024590) has the molecular formula C8H13NO5 and a molecular weight of 203.19 g/mol. Its IUPAC name is acetic acid;1-(2-hydroperoxyethenyl)pyrrolidin-2-one.

Molecular Properties

Compound Nameacetic acid;1-(2-hydroperoxyethenyl)pyrrolidin-2-one
PubChem CID173024590
Molecular FormulaC8H13NO5
Molecular Weight203.19 g/mol
Exact Mass203.08
IUPAC Nameacetic acid;1-(2-hydroperoxyethenyl)pyrrolidin-2-one
SMILESCC(=O)O.O=C1CCCN1C=COO
InChIInChI=1S/C6H9NO3.C2H4O2/c8-6-2-1-3-7(6)4-5-10-9;1-2(3)4/h4-5,9H,1-3H2;1H3,(H,3,4)
InChIKeyIFSSVEOVBITOND-UHFFFAOYSA-N
XLogP0.66
TPSA87.07 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500203.19
LogP ≤ 50.66
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}

Analyze acetic acid;1-(2-hydroperoxyethenyl)pyrrolidin-2-one with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of acetic acid;1-(2-hydroperoxyethenyl)pyrrolidin-2-one?
The IUPAC name of acetic acid;1-(2-hydroperoxyethenyl)pyrrolidin-2-one (CID 173024590) is acetic acid;1-(2-hydroperoxyethenyl)pyrrolidin-2-one.
What is the SMILES notation for acetic acid;1-(2-hydroperoxyethenyl)pyrrolidin-2-one?
The canonical SMILES for acetic acid;1-(2-hydroperoxyethenyl)pyrrolidin-2-one is CC(=O)O.O=C1CCCN1C=COO.
What is the InChIKey of acetic acid;1-(2-hydroperoxyethenyl)pyrrolidin-2-one?
The InChIKey is IFSSVEOVBITOND-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9NO3.C2H4O2/c8-6-2-1-3-7(6)4-5-10-9;1-2(3)4/h4-5,9H,1-3H2;1H3,(H,3,4).
What are the key properties of acetic acid;1-(2-hydroperoxyethenyl)pyrrolidin-2-one?
acetic acid;1-(2-hydroperoxyethenyl)pyrrolidin-2-one has a molecular weight of 203.19 g/mol, XLogP of 0.66, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;1-(2-hydroperoxyethenyl)pyrrolidin-2-one is sourced from PubChem (CID 173024590), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).