C14H21NO5 — CID 70589563
4-butoxy-4-oxobut-2-enoic acid;1-ethenylpyrrolidin-2-one (PubChem CID 70589563) has the molecular formula C14H21NO5 and a molecular weight of 283.32 g/mol. Its IUPAC name is 4-butoxy-4-oxobut-2-enoic acid;1-ethenylpyrrolidin-2-one.
| Compound Name | 4-butoxy-4-oxobut-2-enoic acid;1-ethenylpyrrolidin-2-one |
|---|---|
| PubChem CID | 70589563 |
| Molecular Formula | C14H21NO5 |
| Molecular Weight | 283.32 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | 4-butoxy-4-oxobut-2-enoic acid;1-ethenylpyrrolidin-2-one |
| SMILES | C=CN1CCCC1=O.CCCCOC(=O)C=CC(=O)O |
| InChI | InChI=1S/C8H12O4.C6H9NO/c1-2-3-6-12-8(11)5-4-7(9)10;1-2-7-5-3-4-6(7)8/h4-5H,2-3,6H2,1H3,(H,9,10);2H,1,3-5H2 |
| InChIKey | AZIRBINAFMTGNX-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.32 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|