About bis(prop-2-enyl) (Z)-but-2-enedioate;1-ethenylpyrrolidin-2-one
bis(prop-2-enyl) (Z)-but-2-enedioate;1-ethenylpyrrolidin-2-one (PubChem CID 70547170) has the molecular formula C16H21NO5
and a molecular weight of 307.35 g/mol. Its IUPAC name is bis(prop-2-enyl) (Z)-but-2-enedioate;1-ethenylpyrrolidin-2-one.
Molecular Properties
| Compound Name | bis(prop-2-enyl) (Z)-but-2-enedioate;1-ethenylpyrrolidin-2-one |
| PubChem CID | 70547170 |
| Molecular Formula | C16H21NO5 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.14 |
| IUPAC Name | bis(prop-2-enyl) (Z)-but-2-enedioate;1-ethenylpyrrolidin-2-one |
| SMILES | C=CCOC(=O)/C=C\C(=O)OCC=C.C=CN1CCCC1=O |
| InChI | InChI=1S/C10H12O4.C6H9NO/c1-3-7-13-9(11)5-6-10(12)14-8-4-2;1-2-7-5-3-4-6(7)8/h3-6H,1-2,7-8H2;2H,1,3-5H2/b6-5-; |
| InChIKey | KPFPKTUTMZMHJS-YSMBQZINSA-N |
| XLogP | 1.75 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze bis(prop-2-enyl) (Z)-but-2-enedioate;1-ethenylpyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(prop-2-enyl) (Z)-but-2-enedioate;1-ethenylpyrrolidin-2-one?
The IUPAC name of bis(prop-2-enyl) (Z)-but-2-enedioate;1-ethenylpyrrolidin-2-one (CID 70547170) is bis(prop-2-enyl) (Z)-but-2-enedioate;1-ethenylpyrrolidin-2-one.
What is the SMILES notation for bis(prop-2-enyl) (Z)-but-2-enedioate;1-ethenylpyrrolidin-2-one?
The canonical SMILES for bis(prop-2-enyl) (Z)-but-2-enedioate;1-ethenylpyrrolidin-2-one is C=CCOC(=O)/C=C\C(=O)OCC=C.C=CN1CCCC1=O.
What is the InChIKey of bis(prop-2-enyl) (Z)-but-2-enedioate;1-ethenylpyrrolidin-2-one?
The InChIKey is KPFPKTUTMZMHJS-YSMBQZINSA-N. The full InChI is InChI=1S/C10H12O4.C6H9NO/c1-3-7-13-9(11)5-6-10(12)14-8-4-2;1-2-7-5-3-4-6(7)8/h3-6H,1-2,7-8H2;2H,1,3-5H2/b6-5-;.
What are the key properties of bis(prop-2-enyl) (Z)-but-2-enedioate;1-ethenylpyrrolidin-2-one?
bis(prop-2-enyl) (Z)-but-2-enedioate;1-ethenylpyrrolidin-2-one has a molecular weight of 307.35 g/mol, XLogP of 1.75, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for bis(prop-2-enyl) (Z)-but-2-enedioate;1-ethenylpyrrolidin-2-one is sourced from PubChem (CID 70547170), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).