About 1-ethenylpyrrolidin-2-one;2-(2-hydroxyethoxy)ethanol
1-ethenylpyrrolidin-2-one;2-(2-hydroxyethoxy)ethanol (PubChem CID 174919538) has the molecular formula C10H19NO4
and a molecular weight of 217.26 g/mol. Its IUPAC name is 1-ethenylpyrrolidin-2-one;2-(2-hydroxyethoxy)ethanol.
Molecular Properties
| Compound Name | 1-ethenylpyrrolidin-2-one;2-(2-hydroxyethoxy)ethanol |
| PubChem CID | 174919538 |
| Molecular Formula | C10H19NO4 |
| Molecular Weight | 217.26 g/mol |
| Exact Mass | 217.13 |
| IUPAC Name | 1-ethenylpyrrolidin-2-one;2-(2-hydroxyethoxy)ethanol |
| SMILES | C=CN1CCCC1=O.OCCOCCO |
| InChI | InChI=1S/C6H9NO.C4H10O3/c1-2-7-5-3-4-6(7)8;5-1-3-7-4-2-6/h2H,1,3-5H2;5-6H,1-4H2 |
| InChIKey | GOEMBTNLNVYZDO-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.26 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-ethenylpyrrolidin-2-one;2-(2-hydroxyethoxy)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethenylpyrrolidin-2-one;2-(2-hydroxyethoxy)ethanol?
The IUPAC name of 1-ethenylpyrrolidin-2-one;2-(2-hydroxyethoxy)ethanol (CID 174919538) is 1-ethenylpyrrolidin-2-one;2-(2-hydroxyethoxy)ethanol.
What is the SMILES notation for 1-ethenylpyrrolidin-2-one;2-(2-hydroxyethoxy)ethanol?
The canonical SMILES for 1-ethenylpyrrolidin-2-one;2-(2-hydroxyethoxy)ethanol is C=CN1CCCC1=O.OCCOCCO.
What is the InChIKey of 1-ethenylpyrrolidin-2-one;2-(2-hydroxyethoxy)ethanol?
The InChIKey is GOEMBTNLNVYZDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9NO.C4H10O3/c1-2-7-5-3-4-6(7)8;5-1-3-7-4-2-6/h2H,1,3-5H2;5-6H,1-4H2.
What are the key properties of 1-ethenylpyrrolidin-2-one;2-(2-hydroxyethoxy)ethanol?
1-ethenylpyrrolidin-2-one;2-(2-hydroxyethoxy)ethanol has a molecular weight of 217.26 g/mol, XLogP of -0.26, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethenylpyrrolidin-2-one;2-(2-hydroxyethoxy)ethanol is sourced from PubChem (CID 174919538), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).