About 1-ethenylpyrrolidin-2-one;prop-2-en-1-amine
1-ethenylpyrrolidin-2-one;prop-2-en-1-amine (PubChem CID 134564650) has the molecular formula C9H16N2O
and a molecular weight of 168.24 g/mol. Its IUPAC name is 1-ethenylpyrrolidin-2-one;prop-2-en-1-amine.
Molecular Properties
| Compound Name | 1-ethenylpyrrolidin-2-one;prop-2-en-1-amine |
| PubChem CID | 134564650 |
| Molecular Formula | C9H16N2O |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.13 |
| IUPAC Name | 1-ethenylpyrrolidin-2-one;prop-2-en-1-amine |
| SMILES | C=CCN.C=CN1CCCC1=O |
| InChI | InChI=1S/C6H9NO.C3H7N/c1-2-7-5-3-4-6(7)8;1-2-3-4/h2H,1,3-5H2;2H,1,3-4H2 |
| InChIKey | AHCHTZKDDAMMNF-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-ethenylpyrrolidin-2-one;prop-2-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethenylpyrrolidin-2-one;prop-2-en-1-amine?
The IUPAC name of 1-ethenylpyrrolidin-2-one;prop-2-en-1-amine (CID 134564650) is 1-ethenylpyrrolidin-2-one;prop-2-en-1-amine.
What is the SMILES notation for 1-ethenylpyrrolidin-2-one;prop-2-en-1-amine?
The canonical SMILES for 1-ethenylpyrrolidin-2-one;prop-2-en-1-amine is C=CCN.C=CN1CCCC1=O.
What is the InChIKey of 1-ethenylpyrrolidin-2-one;prop-2-en-1-amine?
The InChIKey is AHCHTZKDDAMMNF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9NO.C3H7N/c1-2-7-5-3-4-6(7)8;1-2-3-4/h2H,1,3-5H2;2H,1,3-4H2.
What are the key properties of 1-ethenylpyrrolidin-2-one;prop-2-en-1-amine?
1-ethenylpyrrolidin-2-one;prop-2-en-1-amine has a molecular weight of 168.24 g/mol, XLogP of 0.88, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethenylpyrrolidin-2-one;prop-2-en-1-amine is sourced from PubChem (CID 134564650), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).