About 1-ethenylpyrrolidin-2-one;hydron;methyl sulfate
1-ethenylpyrrolidin-2-one;hydron;methyl sulfate (PubChem CID 161223280) has the molecular formula C7H13NO5S
and a molecular weight of 223.25 g/mol. Its IUPAC name is 1-ethenylpyrrolidin-2-one;hydron;methyl sulfate.
Molecular Properties
| Compound Name | 1-ethenylpyrrolidin-2-one;hydron;methyl sulfate |
| PubChem CID | 161223280 |
| Molecular Formula | C7H13NO5S |
| Molecular Weight | 223.25 g/mol |
| Exact Mass | 223.05 |
| IUPAC Name | 1-ethenylpyrrolidin-2-one;hydron;methyl sulfate |
| SMILES | C=CN1CCCC1=O.COS(=O)(=O)[O-].[H+] |
| InChI | InChI=1S/C6H9NO.CH4O4S/c1-2-7-5-3-4-6(7)8;1-5-6(2,3)4/h2H,1,3-5H2;1H3,(H,2,3,4) |
| InChIKey | UXUHZCGFAFCHSX-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.25 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|
Analyze 1-ethenylpyrrolidin-2-one;hydron;methyl sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethenylpyrrolidin-2-one;hydron;methyl sulfate?
The IUPAC name of 1-ethenylpyrrolidin-2-one;hydron;methyl sulfate (CID 161223280) is 1-ethenylpyrrolidin-2-one;hydron;methyl sulfate.
What is the SMILES notation for 1-ethenylpyrrolidin-2-one;hydron;methyl sulfate?
The canonical SMILES for 1-ethenylpyrrolidin-2-one;hydron;methyl sulfate is C=CN1CCCC1=O.COS(=O)(=O)[O-].[H+].
What is the InChIKey of 1-ethenylpyrrolidin-2-one;hydron;methyl sulfate?
The InChIKey is UXUHZCGFAFCHSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9NO.CH4O4S/c1-2-7-5-3-4-6(7)8;1-5-6(2,3)4/h2H,1,3-5H2;1H3,(H,2,3,4).
What are the key properties of 1-ethenylpyrrolidin-2-one;hydron;methyl sulfate?
1-ethenylpyrrolidin-2-one;hydron;methyl sulfate has a molecular weight of 223.25 g/mol, XLogP of -0.04, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethenylpyrrolidin-2-one;hydron;methyl sulfate is sourced from PubChem (CID 161223280), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).