About 1-ethenylpiperidin-2-one;1-ethenylpyrrolidin-2-one
1-ethenylpiperidin-2-one;1-ethenylpyrrolidin-2-one (PubChem CID 22992740) has the molecular formula C13H20N2O2
and a molecular weight of 236.31 g/mol. Its IUPAC name is 1-ethenylpiperidin-2-one;1-ethenylpyrrolidin-2-one.
Molecular Properties
| Compound Name | 1-ethenylpiperidin-2-one;1-ethenylpyrrolidin-2-one |
| PubChem CID | 22992740 |
| Molecular Formula | C13H20N2O2 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.15 |
| IUPAC Name | 1-ethenylpiperidin-2-one;1-ethenylpyrrolidin-2-one |
| SMILES | C=CN1CCCC1=O.C=CN1CCCCC1=O |
| InChI | InChI=1S/C7H11NO.C6H9NO/c1-2-8-6-4-3-5-7(8)9;1-2-7-5-3-4-6(7)8/h2H,1,3-6H2;2H,1,3-5H2 |
| InChIKey | BFBWJOBGGWAPQC-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-ethenylpiperidin-2-one;1-ethenylpyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethenylpiperidin-2-one;1-ethenylpyrrolidin-2-one?
The IUPAC name of 1-ethenylpiperidin-2-one;1-ethenylpyrrolidin-2-one (CID 22992740) is 1-ethenylpiperidin-2-one;1-ethenylpyrrolidin-2-one.
What is the SMILES notation for 1-ethenylpiperidin-2-one;1-ethenylpyrrolidin-2-one?
The canonical SMILES for 1-ethenylpiperidin-2-one;1-ethenylpyrrolidin-2-one is C=CN1CCCC1=O.C=CN1CCCCC1=O.
What is the InChIKey of 1-ethenylpiperidin-2-one;1-ethenylpyrrolidin-2-one?
The InChIKey is BFBWJOBGGWAPQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11NO.C6H9NO/c1-2-8-6-4-3-5-7(8)9;1-2-7-5-3-4-6(7)8/h2H,1,3-6H2;2H,1,3-5H2.
What are the key properties of 1-ethenylpiperidin-2-one;1-ethenylpyrrolidin-2-one?
1-ethenylpiperidin-2-one;1-ethenylpyrrolidin-2-one has a molecular weight of 236.31 g/mol, XLogP of 1.89, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethenylpiperidin-2-one;1-ethenylpyrrolidin-2-one is sourced from PubChem (CID 22992740), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).