About CID 118536399
CID 118536399 (PubChem CID 118536399) has the molecular formula C6H11N2O3S-
and a molecular weight of 191.23 g/mol.
Molecular Properties
| Compound Name | CID 118536399 |
| PubChem CID | 118536399 |
| Molecular Formula | C6H11N2O3S- |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.05 |
| IUPAC Name | — |
| SMILES | C=CN1CCCC1=O.NS(=O)[O-] |
| InChI | InChI=1S/C6H9NO.H3NO2S/c1-2-7-5-3-4-6(7)8;1-4(2)3/h2H,1,3-5H2;1H2,(H,2,3)/p-1 |
| InChIKey | QPKZNAPALCZQRF-UHFFFAOYSA-M |
| XLogP | -0.51 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze CID 118536399 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 118536399?
The IUPAC name of CID 118536399 (CID 118536399) is not available.
What is the SMILES notation for CID 118536399?
The canonical SMILES for CID 118536399 is C=CN1CCCC1=O.NS(=O)[O-].
What is the InChIKey of CID 118536399?
The InChIKey is QPKZNAPALCZQRF-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H9NO.H3NO2S/c1-2-7-5-3-4-6(7)8;1-4(2)3/h2H,1,3-5H2;1H2,(H,2,3)/p-1.
What are the key properties of CID 118536399?
CID 118536399 has a molecular weight of 191.23 g/mol, XLogP of -0.51, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 118536399 is sourced from PubChem (CID 118536399), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).