C11H17NO4 — CID 70369148
1-ethenylpyrrolidin-2-one;(Z)-2-hydroxypent-2-enoic acid (PubChem CID 70369148) has the molecular formula C11H17NO4 and a molecular weight of 227.26 g/mol. Its IUPAC name is 1-ethenylpyrrolidin-2-one;(Z)-2-hydroxypent-2-enoic acid.
| Compound Name | 1-ethenylpyrrolidin-2-one;(Z)-2-hydroxypent-2-enoic acid |
|---|---|
| PubChem CID | 70369148 |
| Molecular Formula | C11H17NO4 |
| Molecular Weight | 227.26 g/mol |
| Exact Mass | 227.12 |
| IUPAC Name | 1-ethenylpyrrolidin-2-one;(Z)-2-hydroxypent-2-enoic acid |
| SMILES | C=CN1CCCC1=O.CC/C=C(\O)C(=O)O |
| InChI | InChI=1S/C6H9NO.C5H8O3/c1-2-7-5-3-4-6(7)8;1-2-3-4(6)5(7)8/h2H,1,3-5H2;3,6H,2H2,1H3,(H,7,8)/b;4-3- |
| InChIKey | PMSSBNAJUWPHLY-QGAMPUOQSA-N |
| XLogP | 1.68 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.26 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|