About 1-(2,2-dihydroxyethenyl)pyrrolidin-2-one
1-(2,2-dihydroxyethenyl)pyrrolidin-2-one (PubChem CID 175238388) has the molecular formula C6H9NO3
and a molecular weight of 143.14 g/mol. Its IUPAC name is 1-(2,2-dihydroxyethenyl)pyrrolidin-2-one.
Molecular Properties
| Compound Name | 1-(2,2-dihydroxyethenyl)pyrrolidin-2-one |
| PubChem CID | 175238388 |
| Molecular Formula | C6H9NO3 |
| Molecular Weight | 143.14 g/mol |
| Exact Mass | 143.06 |
| IUPAC Name | 1-(2,2-dihydroxyethenyl)pyrrolidin-2-one |
| SMILES | O=C1CCCN1C=C(O)O |
| InChI | InChI=1S/C6H9NO3/c8-5-2-1-3-7(5)4-6(9)10/h4,9-10H,1-3H2 |
| InChIKey | HQSNTGNPPSBPSV-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.14 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze 1-(2,2-dihydroxyethenyl)pyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,2-dihydroxyethenyl)pyrrolidin-2-one?
The IUPAC name of 1-(2,2-dihydroxyethenyl)pyrrolidin-2-one (CID 175238388) is 1-(2,2-dihydroxyethenyl)pyrrolidin-2-one.
What is the SMILES notation for 1-(2,2-dihydroxyethenyl)pyrrolidin-2-one?
The canonical SMILES for 1-(2,2-dihydroxyethenyl)pyrrolidin-2-one is O=C1CCCN1C=C(O)O.
What is the InChIKey of 1-(2,2-dihydroxyethenyl)pyrrolidin-2-one?
The InChIKey is HQSNTGNPPSBPSV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9NO3/c8-5-2-1-3-7(5)4-6(9)10/h4,9-10H,1-3H2.
What are the key properties of 1-(2,2-dihydroxyethenyl)pyrrolidin-2-one?
1-(2,2-dihydroxyethenyl)pyrrolidin-2-one has a molecular weight of 143.14 g/mol, XLogP of 0.52, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,2-dihydroxyethenyl)pyrrolidin-2-one is sourced from PubChem (CID 175238388), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).